frankbowler7 frankbowler7

11-04-2020
Mathematics

contestada

If x1=4, compute the value of x2 if the mean is 1

Respuesta :

gregtheslime gregtheslime

11-04-2020

Answer:x2 = -2

Step-by-step explanation: Since the mean is 1, the sum of x1 and x2 is 1 times 2 = 2. In order to reach 2, x2 is equal to -2, as 4-2 = 2.

Answer Link

Otras preguntas

simplify. (9x2- 8x-3) + (2x+8) A. 11x + 10x +5 B. 9x2-6x+5 C. 9x2+10x-11 D. 11x2-6x-11

In paragraph 8, how does the power of the old tree support the theme of the story. Use 2 details from the text to support your response.

Which of the following coordinates correspond to a body of water? O 10° S latitude, 20° E longitude O 20° S latitude, 20° E longitude O 30° S latitude, 10° E lo

. Saving "for a rainy day" means saving (a) for a new roof for one's home (b) for retirement (c) for a college education (d) to meet unexpected expenses.

6x = 18 what does x =

A teacher gave her students two tests. If 45% of the students passed both tests and 60% passed the first test. What is the probability that a student who passed

write a cosine function that has a midline of 4, an amplitude or 3 and a period of 7/3

PLEASE HELP SERIOUSLY NEED IT

Which recent local, national or international current event (within the past year) has captured your attention and WHY? Please be specific and include: 1- when

Draw the best Lewis structure for CH3CH(CH3)CH2C(CH2CH3)2CHO, a neutral molecule. HELP PLEASE