lynette3453 lynette3453

15-06-2020
Chemistry

contestada

5. What volume would you need to dilute 0.2 L of a 15 M solution to obtain a 3 M
solution?

Respuesta :

appletonparkers63 appletonparkers63

15-06-2020

Answer:

IL

Explanation:

M_1 V_1 = M_2 V_2

M_1 = 15 M

V_1 = 0.2 L

M_2 = 3 M

V_2 = ?

15 x 0.2 = 3V_2

15 x 0.2 = 3

3 / 3V_2

1 L= V_2

Answer Link

Otras preguntas

ch3ch2ch(c6h5)ch(ch3)ch2ch3spell out the full name of the compound.

given that that y is inversely proportional to the cube root of x, and that x=64 when y = 12.75. 1.find the equation connecting x and u. 2. find the value of x

All of the following are in the Latin European cultural cluster EXCEPT France Israel Spain Belgium

n snmp management station receives snmp notifications from agents on udp port:_______

most ads have little impact on the customer because they are driven by informational motives.

A cly has a population of 390,000 people. Suppose that each year the population grows by 7.75%. What will the population be after 15 years? Use the calculator p

Consider the efficient market hypothesis as it relates to the stock market. If the weak form of efficiency holds, then which of these statements is true? a. Sto

Evidence that supports quasars being the nuclei of very distant galaxies includes 1) the existence of quasar fuzz. 2) the observation of a supernova near a quas

if a customer leaves your business and is arrested for duii, they may face penalties that include:

a. Describe what disadvantages local farmers might experience if a forest on hills above their land was chopped down. b. Suggest what effect this deforestation