14-04-2017
Physics

contestada

Which of the following numbers most closely represents the number of galaxies in the universe?
A)hundreds
B)thousands
C)millions
D)billions

Respuesta :

Equanimity Equanimity

14-04-2017

There are an estimated 100 billion, so the answer would be D.) Billions

Answer Link

Otras preguntas

why is nursing's collective voice weak in comparison to their numbers

HELP If the distance from the boat to the lighthouse is 115 meters and the angle of elevation is 42", which of the following equations will find the height of t

Answer questions please !!! photo attached

Part 4. NO LINKS!! Find the area of the shaded area shown. SHOW WORK PLEASE !! #21

Find the value of the length x rounded to 1 DP.

Give an example App, do you think has a weak user interface? Why?

PLEASE HELP ME!!! I'm completely lost and I don't have much time left for this complicated task! Describe the conquest of the "New World" by the Spanish conquis

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

Anju lost 2300 on a sofa set that she sold for 34,455. At what price did she buy the sofa set?

Use the substitution method to solve the linear system. 4×- 7y = 20 X- 3y = 10