diamondmoss1022 diamondmoss1022

14-07-2015
Mathematics

contestada

A team of 10 players is to be selected from a class of 6 girls and 7 boys. what is the probability that a randomly chosen team has 3 girls and 7 boys

Respuesta :

jakedc0614 jakedc0614

14-07-2015

1/4 because there are only 4 possible combinations: 7 boys,3 girls 6 boys, 4 girls 5 boys, 5 girls or 4 boys and 6 girls

Answer Link

Otras preguntas

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

Which interest group is an example of a public interest group?.

70 is what percent of 350?

does someone mind helping me with this problem? Thank you!

What happens during S Phase? A. Cytoplasm is manufactured B. The Cell splits in two C. DNA separates into two nulclei D. Chromosomes are duplicated

Parallel lines q and q are cut by transversal r forming 4 angles at each intersection. At the intersection of lines r and q, clockwise from top left, the angles

which term below as "the amount of work that can be performed"? A. Mass B. Temperature C. Energy D. Weight

Which of these inspired reform movements such as temperance, abolition, and women's rights in America in the 1800s?

Doubling the dimensions of a rectangle increases the area by a factor of 4. If p represents doubling the dimensions of a rectangle and q represents the area inc

PROJECT: EXPLORING IDENTITY1. What is your first name, and why did your family choose to give you this name? What meaning does your name have?2. What is your la